C17H15N5O4 — CID 22905799
methyl 4-[[4-nitro-N-(1,2,4-triazol-4-yl)anilino]methyl]benzoate (PubChem CID 22905799) has the molecular formula C17H15N5O4 and a molecular weight of 353.34 g/mol. Its IUPAC name is methyl 4-[[4-nitro-N-(1,2,4-triazol-4-yl)anilino]methyl]benzoate.
| Compound Name | methyl 4-[[4-nitro-N-(1,2,4-triazol-4-yl)anilino]methyl]benzoate |
|---|---|
| PubChem CID | 22905799 |
| Molecular Formula | C17H15N5O4 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | methyl 4-[[4-nitro-N-(1,2,4-triazol-4-yl)anilino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(c2ccc([N+](=O)[O-])cc2)n2cnnc2)cc1 |
| InChI | InChI=1S/C17H15N5O4/c1-26-17(23)14-4-2-13(3-5-14)10-21(20-11-18-19-12-20)15-6-8-16(9-7-15)22(24)25/h2-9,11-12H,10H2,1H3 |
| InChIKey | ZCTFIGPYDWHPPW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|