C17H15NO4 — CID 10613929
ethyl 2,8-dimethyl-5-oxochromeno[3,4-c]pyridine-1-carboxylate (PubChem CID 10613929) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is ethyl 2,8-dimethyl-5-oxochromeno[3,4-c]pyridine-1-carboxylate.
| Compound Name | ethyl 2,8-dimethyl-5-oxochromeno[3,4-c]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 10613929 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | ethyl 2,8-dimethyl-5-oxochromeno[3,4-c]pyridine-1-carboxylate |
| SMILES | CCOC(=O)c1c(C)ncc2c(=O)oc3cc(C)ccc3c12 |
| InChI | InChI=1S/C17H15NO4/c1-4-21-17(20)14-10(3)18-8-12-15(14)11-6-5-9(2)7-13(11)22-16(12)19/h5-8H,4H2,1-3H3 |
| InChIKey | MICNHFPZNDBEBZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|