C8H9BrCl2N2O — CID 10614134
2-(4-bromobutyl)-4,5-dichloropyridazin-3-one (PubChem CID 10614134) has the molecular formula C8H9BrCl2N2O and a molecular weight of 299.98 g/mol. Its IUPAC name is 2-(4-bromobutyl)-4,5-dichloropyridazin-3-one.
| Compound Name | 2-(4-bromobutyl)-4,5-dichloropyridazin-3-one |
|---|---|
| PubChem CID | 10614134 |
| Molecular Formula | C8H9BrCl2N2O |
| Molecular Weight | 299.98 g/mol |
| Exact Mass | 297.93 |
| IUPAC Name | 2-(4-bromobutyl)-4,5-dichloropyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1CCCCBr |
| InChI | InChI=1S/C8H9BrCl2N2O/c9-3-1-2-4-13-8(14)7(11)6(10)5-12-13/h5H,1-4H2 |
| InChIKey | DJGOSPPUAAALQG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.98 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|