C11H27N3O2S — CID 106141699
2,2-dimethyl-N-(2-methylpropylsulfamoyl)pentane-1,5-diamine (PubChem CID 106141699) has the molecular formula C11H27N3O2S and a molecular weight of 265.42 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2-methylpropylsulfamoyl)pentane-1,5-diamine.
| Compound Name | 2,2-dimethyl-N-(2-methylpropylsulfamoyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 106141699 |
| Molecular Formula | C11H27N3O2S |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2,2-dimethyl-N-(2-methylpropylsulfamoyl)pentane-1,5-diamine |
| SMILES | CC(C)CNS(=O)(=O)NCC(C)(C)CCCN |
| InChI | InChI=1S/C11H27N3O2S/c1-10(2)8-13-17(15,16)14-9-11(3,4)6-5-7-12/h10,13-14H,5-9,12H2,1-4H3 |
| InChIKey | BIMPDJNGWVSWKQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |