C10H25N3O2S — CID 106141897
2,2-dimethyl-N-(propylsulfamoyl)pentane-1,5-diamine (PubChem CID 106141897) has the molecular formula C10H25N3O2S and a molecular weight of 251.40 g/mol. Its IUPAC name is 2,2-dimethyl-N-(propylsulfamoyl)pentane-1,5-diamine.
| Compound Name | 2,2-dimethyl-N-(propylsulfamoyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 106141897 |
| Molecular Formula | C10H25N3O2S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2,2-dimethyl-N-(propylsulfamoyl)pentane-1,5-diamine |
| SMILES | CCCNS(=O)(=O)NCC(C)(C)CCCN |
| InChI | InChI=1S/C10H25N3O2S/c1-4-8-12-16(14,15)13-9-10(2,3)6-5-7-11/h12-13H,4-9,11H2,1-3H3 |
| InChIKey | WMEGYKHUZWJIOY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |