C11H25NO2S — CID 20657896
N-(4,4-dimethylpentyl)-2-methylpropane-2-sulfonamide (PubChem CID 20657896) has the molecular formula C11H25NO2S and a molecular weight of 235.39 g/mol. Its IUPAC name is N-(4,4-dimethylpentyl)-2-methylpropane-2-sulfonamide.
| Compound Name | N-(4,4-dimethylpentyl)-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 20657896 |
| Molecular Formula | C11H25NO2S |
| Molecular Weight | 235.39 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-(4,4-dimethylpentyl)-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)CCCNS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C11H25NO2S/c1-10(2,3)8-7-9-12-15(13,14)11(4,5)6/h12H,7-9H2,1-6H3 |
| InChIKey | MQLOQBKLCJAABB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|