C12H17ClN2O2 — CID 106143316
N-(4-chloro-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 106143316) has the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. Its IUPAC name is N-(4-chloro-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(4-chloro-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 106143316 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-(4-chloro-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | CC(C)(CCCl)CNC(=O)c1c[nH]ccc1=O |
| InChI | InChI=1S/C12H17ClN2O2/c1-12(2,4-5-13)8-15-11(17)9-7-14-6-3-10(9)16/h3,6-7H,4-5,8H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | QUSAMDGVCRGSCD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|