C14H29NOS — CID 106144566
5-[(5,5-dimethylthian-3-yl)amino]-4,4-dimethylpentan-1-ol (PubChem CID 106144566) has the molecular formula C14H29NOS and a molecular weight of 259.46 g/mol. Its IUPAC name is 5-[(5,5-dimethylthian-3-yl)amino]-4,4-dimethylpentan-1-ol.
| Compound Name | 5-[(5,5-dimethylthian-3-yl)amino]-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 106144566 |
| Molecular Formula | C14H29NOS |
| Molecular Weight | 259.46 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 5-[(5,5-dimethylthian-3-yl)amino]-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(CCCO)CNC1CSCC(C)(C)C1 |
| InChI | InChI=1S/C14H29NOS/c1-13(2,6-5-7-16)10-15-12-8-14(3,4)11-17-9-12/h12,15-16H,5-11H2,1-4H3 |
| InChIKey | WYMUQMBOPOKQLJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |