C12H25NO2S — CID 107864992
2-[(5,5-dimethylthian-3-yl)amino]-2-ethylpropane-1,3-diol (PubChem CID 107864992) has the molecular formula C12H25NO2S and a molecular weight of 247.40 g/mol. Its IUPAC name is 2-[(5,5-dimethylthian-3-yl)amino]-2-ethylpropane-1,3-diol.
| Compound Name | 2-[(5,5-dimethylthian-3-yl)amino]-2-ethylpropane-1,3-diol |
|---|---|
| PubChem CID | 107864992 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-[(5,5-dimethylthian-3-yl)amino]-2-ethylpropane-1,3-diol |
| SMILES | CCC(CO)(CO)NC1CSCC(C)(C)C1 |
| InChI | InChI=1S/C12H25NO2S/c1-4-12(7-14,8-15)13-10-5-11(2,3)9-16-6-10/h10,13-15H,4-9H2,1-3H3 |
| InChIKey | LIVVVXHFTJBASU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |