C15H20N2O2 — CID 106144792
3-[(4-hydroxy-2,2-dimethylbutyl)amino]-2H-isoquinolin-1-one (PubChem CID 106144792) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-[(4-hydroxy-2,2-dimethylbutyl)amino]-2H-isoquinolin-1-one.
| Compound Name | 3-[(4-hydroxy-2,2-dimethylbutyl)amino]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 106144792 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 3-[(4-hydroxy-2,2-dimethylbutyl)amino]-2H-isoquinolin-1-one |
| SMILES | CC(C)(CCO)CNc1cc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H20N2O2/c1-15(2,7-8-18)10-16-13-9-11-5-3-4-6-12(11)14(19)17-13/h3-6,9,18H,7-8,10H2,1-2H3,(H2,16,17,19) |
| InChIKey | NLCOOMZRINWWBF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |