C16H22BrNO3 — CID 106145351
N-(5-bromo-2,2-dimethylpentyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide (PubChem CID 106145351) has the molecular formula C16H22BrNO3 and a molecular weight of 356.26 g/mol. Its IUPAC name is N-(5-bromo-2,2-dimethylpentyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide.
| Compound Name | N-(5-bromo-2,2-dimethylpentyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
|---|---|
| PubChem CID | 106145351 |
| Molecular Formula | C16H22BrNO3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-(5-bromo-2,2-dimethylpentyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
| SMILES | CC(C)(CCCBr)CNC(=O)c1cccc2c1OCCO2 |
| InChI | InChI=1S/C16H22BrNO3/c1-16(2,7-4-8-17)11-18-15(19)12-5-3-6-13-14(12)21-10-9-20-13/h3,5-6H,4,7-11H2,1-2H3,(H,18,19) |
| InChIKey | RGYULLXZTTYMTP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|