C13H20BrNOS — CID 106145359
N-(5-bromo-2,2-dimethylpentyl)-2-thiophen-2-ylacetamide (PubChem CID 106145359) has the molecular formula C13H20BrNOS and a molecular weight of 318.28 g/mol. Its IUPAC name is N-(5-bromo-2,2-dimethylpentyl)-2-thiophen-2-ylacetamide.
| Compound Name | N-(5-bromo-2,2-dimethylpentyl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 106145359 |
| Molecular Formula | C13H20BrNOS |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-(5-bromo-2,2-dimethylpentyl)-2-thiophen-2-ylacetamide |
| SMILES | CC(C)(CCCBr)CNC(=O)Cc1cccs1 |
| InChI | InChI=1S/C13H20BrNOS/c1-13(2,6-4-7-14)10-15-12(16)9-11-5-3-8-17-11/h3,5,8H,4,6-7,9-10H2,1-2H3,(H,15,16) |
| InChIKey | DYUHNEKUEKWFRJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|