C15H20BrF2NO — CID 106145428
N-(5-bromo-2,2-dimethylpentyl)-2-(2,6-difluorophenyl)acetamide (PubChem CID 106145428) has the molecular formula C15H20BrF2NO and a molecular weight of 348.23 g/mol. Its IUPAC name is N-(5-bromo-2,2-dimethylpentyl)-2-(2,6-difluorophenyl)acetamide.
| Compound Name | N-(5-bromo-2,2-dimethylpentyl)-2-(2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 106145428 |
| Molecular Formula | C15H20BrF2NO |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-(5-bromo-2,2-dimethylpentyl)-2-(2,6-difluorophenyl)acetamide |
| SMILES | CC(C)(CCCBr)CNC(=O)Cc1c(F)cccc1F |
| InChI | InChI=1S/C15H20BrF2NO/c1-15(2,7-4-8-16)10-19-14(20)9-11-12(17)5-3-6-13(11)18/h3,5-6H,4,7-10H2,1-2H3,(H,19,20) |
| InChIKey | IWJRKRYLKUVZEF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|