C10H18BrN3O2S — CID 106145835
N-(4-bromo-2,2-dimethylbutyl)-1-methylpyrazole-4-sulfonamide (PubChem CID 106145835) has the molecular formula C10H18BrN3O2S and a molecular weight of 324.24 g/mol. Its IUPAC name is N-(4-bromo-2,2-dimethylbutyl)-1-methylpyrazole-4-sulfonamide.
| Compound Name | N-(4-bromo-2,2-dimethylbutyl)-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106145835 |
| Molecular Formula | C10H18BrN3O2S |
| Molecular Weight | 324.24 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | N-(4-bromo-2,2-dimethylbutyl)-1-methylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NCC(C)(C)CCBr)cn1 |
| InChI | InChI=1S/C10H18BrN3O2S/c1-10(2,4-5-11)8-13-17(15,16)9-6-12-14(3)7-9/h6-7,13H,4-5,8H2,1-3H3 |
| InChIKey | UGXLKNIIEAUUDR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|