C15H29N5O — CID 106150303
5-[(6-hydrazinyl-5-methyl-2-propylpyrimidin-4-yl)amino]-4,4-dimethylpentan-1-ol (PubChem CID 106150303) has the molecular formula C15H29N5O and a molecular weight of 295.43 g/mol. Its IUPAC name is 5-[(6-hydrazinyl-5-methyl-2-propylpyrimidin-4-yl)amino]-4,4-dimethylpentan-1-ol.
| Compound Name | 5-[(6-hydrazinyl-5-methyl-2-propylpyrimidin-4-yl)amino]-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 106150303 |
| Molecular Formula | C15H29N5O |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.24 |
| IUPAC Name | 5-[(6-hydrazinyl-5-methyl-2-propylpyrimidin-4-yl)amino]-4,4-dimethylpentan-1-ol |
| SMILES | CCCc1nc(NN)c(C)c(NCC(C)(C)CCCO)n1 |
| InChI | InChI=1S/C15H29N5O/c1-5-7-12-18-13(11(2)14(19-12)20-16)17-10-15(3,4)8-6-9-21/h21H,5-10,16H2,1-4H3,(H2,17,18,19,20) |
| InChIKey | LKLPCVPCAKAQMH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|