C9H12BrF2NO4 — CID 10615295
methyl (2E)-3-bromo-3,3-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate (PubChem CID 10615295) has the molecular formula C9H12BrF2NO4 and a molecular weight of 316.10 g/mol. Its IUPAC name is methyl (2E)-3-bromo-3,3-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate.
| Compound Name | methyl (2E)-3-bromo-3,3-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate |
|---|---|
| PubChem CID | 10615295 |
| Molecular Formula | C9H12BrF2NO4 |
| Molecular Weight | 316.10 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | methyl (2E)-3-bromo-3,3-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate |
| SMILES | COC(=O)/C(=N\C(=O)OC(C)(C)C)C(F)(F)Br |
| InChI | InChI=1S/C9H12BrF2NO4/c1-8(2,3)17-7(15)13-5(6(14)16-4)9(10,11)12/h1-4H3/b13-5+ |
| InChIKey | XHDSXNBOWNKKTL-WLRTZDKTSA-N |
| XLogP | 2.52 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.10 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|