C9H13F2NO4 — CID 10752337
methyl (2E)-3,3-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate (PubChem CID 10752337) has the molecular formula C9H13F2NO4 and a molecular weight of 237.20 g/mol. Its IUPAC name is methyl (2E)-3,3-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate.
| Compound Name | methyl (2E)-3,3-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate |
|---|---|
| PubChem CID | 10752337 |
| Molecular Formula | C9H13F2NO4 |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | methyl (2E)-3,3-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoate |
| SMILES | COC(=O)/C(=N\C(=O)OC(C)(C)C)C(F)F |
| InChI | InChI=1S/C9H13F2NO4/c1-9(2,3)16-8(14)12-5(6(10)11)7(13)15-4/h6H,1-4H3/b12-5- |
| InChIKey | QHIHWRMAXFYBHV-XGICHPGQSA-N |
| XLogP | 1.80 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|