C8H10F3NO4 — CID 2758838
ethyl 2-ethoxycarbonylimino-3,3,3-trifluoropropanoate (PubChem CID 2758838) has the molecular formula C8H10F3NO4 and a molecular weight of 241.16 g/mol. Its IUPAC name is ethyl 2-ethoxycarbonylimino-3,3,3-trifluoropropanoate.
| Compound Name | ethyl 2-ethoxycarbonylimino-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 2758838 |
| Molecular Formula | C8H10F3NO4 |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | ethyl 2-ethoxycarbonylimino-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)N=C(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO4/c1-3-15-6(13)5(8(9,10)11)12-7(14)16-4-2/h3-4H2,1-2H3 |
| InChIKey | PWYYIAKBASUUEE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|