C7H8F3NO4 — CID 2759848
methyl 2-ethoxycarbonylimino-3,3,3-trifluoropropanoate (PubChem CID 2759848) has the molecular formula C7H8F3NO4 and a molecular weight of 227.14 g/mol. Its IUPAC name is methyl 2-ethoxycarbonylimino-3,3,3-trifluoropropanoate.
| Compound Name | methyl 2-ethoxycarbonylimino-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 2759848 |
| Molecular Formula | C7H8F3NO4 |
| Molecular Weight | 227.14 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | methyl 2-ethoxycarbonylimino-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)N=C(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C7H8F3NO4/c1-3-15-6(13)11-4(5(12)14-2)7(8,9)10/h3H2,1-2H3 |
| InChIKey | RJEMIPZJWKAIED-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.14 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|