C7H5F6NO3 — CID 2758939
ethyl 3,3,3-trifluoro-2-(2,2,2-trifluoroacetyl)iminopropanoate (PubChem CID 2758939) has the molecular formula C7H5F6NO3 and a molecular weight of 265.11 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-(2,2,2-trifluoroacetyl)iminopropanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-(2,2,2-trifluoroacetyl)iminopropanoate |
|---|---|
| PubChem CID | 2758939 |
| Molecular Formula | C7H5F6NO3 |
| Molecular Weight | 265.11 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-(2,2,2-trifluoroacetyl)iminopropanoate |
| SMILES | CCOC(=O)/C(=N\C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H5F6NO3/c1-2-17-4(15)3(6(8,9)10)14-5(16)7(11,12)13/h2H2,1H3/b14-3+ |
| InChIKey | FJAHWMXSGSBUES-LZWSPWQCSA-N |
| XLogP | 1.64 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.11 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|