C8H10F3NO4 — CID 23088116
(2E)-3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoic acid (PubChem CID 23088116) has the molecular formula C8H10F3NO4 and a molecular weight of 241.16 g/mol. Its IUPAC name is (2E)-3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoic acid.
| Compound Name | (2E)-3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoic acid |
|---|---|
| PubChem CID | 23088116 |
| Molecular Formula | C8H10F3NO4 |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | (2E)-3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylimino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)/N=C(\C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO4/c1-7(2,3)16-6(15)12-4(5(13)14)8(9,10)11/h1-3H3,(H,13,14)/b12-4+ |
| InChIKey | SVEBSDJJXSXIBL-UUILKARUSA-N |
| XLogP | 2.01 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|