C12H15ClN4O — CID 106153854
N-(4-chloro-1-methoxybutan-2-yl)pyrido[2,3-b]pyrazin-6-amine (PubChem CID 106153854) has the molecular formula C12H15ClN4O and a molecular weight of 266.73 g/mol. Its IUPAC name is N-(4-chloro-1-methoxybutan-2-yl)pyrido[2,3-b]pyrazin-6-amine.
| Compound Name | N-(4-chloro-1-methoxybutan-2-yl)pyrido[2,3-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 106153854 |
| Molecular Formula | C12H15ClN4O |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | N-(4-chloro-1-methoxybutan-2-yl)pyrido[2,3-b]pyrazin-6-amine |
| SMILES | COCC(CCCl)Nc1ccc2nccnc2n1 |
| InChI | InChI=1S/C12H15ClN4O/c1-18-8-9(4-5-13)16-11-3-2-10-12(17-11)15-7-6-14-10/h2-3,6-7,9H,4-5,8H2,1H3,(H,15,16,17) |
| InChIKey | QNKSNRNDQZRGOL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|