C12H17BrClNO2S — CID 106158915
2-bromo-N-(5-chloro-4-methylpentyl)benzenesulfonamide (PubChem CID 106158915) has the molecular formula C12H17BrClNO2S and a molecular weight of 354.70 g/mol. Its IUPAC name is 2-bromo-N-(5-chloro-4-methylpentyl)benzenesulfonamide.
| Compound Name | 2-bromo-N-(5-chloro-4-methylpentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106158915 |
| Molecular Formula | C12H17BrClNO2S |
| Molecular Weight | 354.70 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 2-bromo-N-(5-chloro-4-methylpentyl)benzenesulfonamide |
| SMILES | CC(CCl)CCCNS(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C12H17BrClNO2S/c1-10(9-14)5-4-8-15-18(16,17)12-7-3-2-6-11(12)13/h2-3,6-7,10,15H,4-5,8-9H2,1H3 |
| InChIKey | LVFTUXAJJMFKDK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.70 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|