C13H20FNO2S — CID 106160629
3-[(2-fluoro-4-methoxyphenyl)methylamino]-2-methylsulfanylbutan-1-ol (PubChem CID 106160629) has the molecular formula C13H20FNO2S and a molecular weight of 273.37 g/mol. Its IUPAC name is 3-[(2-fluoro-4-methoxyphenyl)methylamino]-2-methylsulfanylbutan-1-ol.
| Compound Name | 3-[(2-fluoro-4-methoxyphenyl)methylamino]-2-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 106160629 |
| Molecular Formula | C13H20FNO2S |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 3-[(2-fluoro-4-methoxyphenyl)methylamino]-2-methylsulfanylbutan-1-ol |
| SMILES | COc1ccc(CNC(C)C(CO)SC)c(F)c1 |
| InChI | InChI=1S/C13H20FNO2S/c1-9(13(8-16)18-3)15-7-10-4-5-11(17-2)6-12(10)14/h4-6,9,13,15-16H,7-8H2,1-3H3 |
| InChIKey | CKUWDNCIBRYLTK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |