C13H17F4NOS — CID 111440312
3-[[2-fluoro-5-(trifluoromethyl)phenyl]methylamino]-2-methylsulfanylbutan-1-ol (PubChem CID 111440312) has the molecular formula C13H17F4NOS and a molecular weight of 311.34 g/mol. Its IUPAC name is 3-[[2-fluoro-5-(trifluoromethyl)phenyl]methylamino]-2-methylsulfanylbutan-1-ol.
| Compound Name | 3-[[2-fluoro-5-(trifluoromethyl)phenyl]methylamino]-2-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 111440312 |
| Molecular Formula | C13H17F4NOS |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 3-[[2-fluoro-5-(trifluoromethyl)phenyl]methylamino]-2-methylsulfanylbutan-1-ol |
| SMILES | CSC(CO)C(C)NCc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C13H17F4NOS/c1-8(12(7-19)20-2)18-6-9-5-10(13(15,16)17)3-4-11(9)14/h3-5,8,12,18-19H,6-7H2,1-2H3 |
| InChIKey | NPTKTLRSEVQSSG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |