C13H15F4NO2S — CID 102563013
2-[[2-fluoro-5-(trifluoromethyl)phenyl]methylamino]-4-methylsulfanylbutanoic acid (PubChem CID 102563013) has the molecular formula C13H15F4NO2S and a molecular weight of 325.33 g/mol. Its IUPAC name is 2-[[2-fluoro-5-(trifluoromethyl)phenyl]methylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-fluoro-5-(trifluoromethyl)phenyl]methylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 102563013 |
| Molecular Formula | C13H15F4NO2S |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-[[2-fluoro-5-(trifluoromethyl)phenyl]methylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NCc1cc(C(F)(F)F)ccc1F)C(=O)O |
| InChI | InChI=1S/C13H15F4NO2S/c1-21-5-4-11(12(19)20)18-7-8-6-9(13(15,16)17)2-3-10(8)14/h2-3,6,11,18H,4-5,7H2,1H3,(H,19,20) |
| InChIKey | LFZNSAJBNBEQJA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |