About N-(2,2-difluoro-3-hydroxypropyl)-4-propan-2-ylthiadiazole-5-carboxamide
N-(2,2-difluoro-3-hydroxypropyl)-4-propan-2-ylthiadiazole-5-carboxamide (PubChem CID 106168184) has the molecular formula C9H13F2N3O2S
and a molecular weight of 265.28 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-4-propan-2-ylthiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-4-propan-2-ylthiadiazole-5-carboxamide |
| PubChem CID | 106168184 |
| Molecular Formula | C9H13F2N3O2S |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-4-propan-2-ylthiadiazole-5-carboxamide |
| SMILES | CC(C)c1nnsc1C(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C9H13F2N3O2S/c1-5(2)6-7(17-14-13-6)8(16)12-3-9(10,11)4-15/h5,15H,3-4H2,1-2H3,(H,12,16) |
| InChIKey | IABLHQYDHBCGEY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2,2-difluoro-3-hydroxypropyl)-4-propan-2-ylthiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoro-3-hydroxypropyl)-4-propan-2-ylthiadiazole-5-carboxamide?
The IUPAC name of N-(2,2-difluoro-3-hydroxypropyl)-4-propan-2-ylthiadiazole-5-carboxamide (CID 106168184) is N-(2,2-difluoro-3-hydroxypropyl)-4-propan-2-ylthiadiazole-5-carboxamide.
What is the SMILES notation for N-(2,2-difluoro-3-hydroxypropyl)-4-propan-2-ylthiadiazole-5-carboxamide?
The canonical SMILES for N-(2,2-difluoro-3-hydroxypropyl)-4-propan-2-ylthiadiazole-5-carboxamide is CC(C)c1nnsc1C(=O)NCC(F)(F)CO.
What is the InChIKey of N-(2,2-difluoro-3-hydroxypropyl)-4-propan-2-ylthiadiazole-5-carboxamide?
The InChIKey is IABLHQYDHBCGEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2N3O2S/c1-5(2)6-7(17-14-13-6)8(16)12-3-9(10,11)4-15/h5,15H,3-4H2,1-2H3,(H,12,16).
What are the key properties of N-(2,2-difluoro-3-hydroxypropyl)-4-propan-2-ylthiadiazole-5-carboxamide?
N-(2,2-difluoro-3-hydroxypropyl)-4-propan-2-ylthiadiazole-5-carboxamide has a molecular weight of 265.28 g/mol, XLogP of 1.02, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoro-3-hydroxypropyl)-4-propan-2-ylthiadiazole-5-carboxamide is sourced from PubChem (CID 106168184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).