C23H18N2O — CID 10616982
4-(2,6-diphenyl-5,6-dihydro-4H-1,3-oxazin-4-yl)benzonitrile (PubChem CID 10616982) has the molecular formula C23H18N2O and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-(2,6-diphenyl-5,6-dihydro-4H-1,3-oxazin-4-yl)benzonitrile.
| Compound Name | 4-(2,6-diphenyl-5,6-dihydro-4H-1,3-oxazin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 10616982 |
| Molecular Formula | C23H18N2O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 4-(2,6-diphenyl-5,6-dihydro-4H-1,3-oxazin-4-yl)benzonitrile |
| SMILES | N#Cc1ccc(C2CC(c3ccccc3)OC(c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C23H18N2O/c24-16-17-11-13-18(14-12-17)21-15-22(19-7-3-1-4-8-19)26-23(25-21)20-9-5-2-6-10-20/h1-14,21-22H,15H2 |
| InChIKey | ZBNMSZLDFMYNPS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |