C23H15NO2 — CID 86338758
4-[(2R)-5-oxo-2,4-diphenyl-2H-furan-3-yl]benzonitrile (PubChem CID 86338758) has the molecular formula C23H15NO2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-[(2R)-5-oxo-2,4-diphenyl-2H-furan-3-yl]benzonitrile.
| Compound Name | 4-[(2R)-5-oxo-2,4-diphenyl-2H-furan-3-yl]benzonitrile |
|---|---|
| PubChem CID | 86338758 |
| Molecular Formula | C23H15NO2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 4-[(2R)-5-oxo-2,4-diphenyl-2H-furan-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(C2=C(c3ccccc3)C(=O)O[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H15NO2/c24-15-16-11-13-18(14-12-16)20-21(17-7-3-1-4-8-17)23(25)26-22(20)19-9-5-2-6-10-19/h1-14,22H/t22-/m1/s1 |
| InChIKey | BHHGQFMXWAUCDX-JOCHJYFZSA-N |
| XLogP | 4.77 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|