C15H19BrN2O2S — CID 106169935
N-(1-bromo-3-methylpentan-3-yl)isoquinoline-5-sulfonamide (PubChem CID 106169935) has the molecular formula C15H19BrN2O2S and a molecular weight of 371.30 g/mol. Its IUPAC name is N-(1-bromo-3-methylpentan-3-yl)isoquinoline-5-sulfonamide.
| Compound Name | N-(1-bromo-3-methylpentan-3-yl)isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 106169935 |
| Molecular Formula | C15H19BrN2O2S |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | N-(1-bromo-3-methylpentan-3-yl)isoquinoline-5-sulfonamide |
| SMILES | CCC(C)(CCBr)NS(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C15H19BrN2O2S/c1-3-15(2,8-9-16)18-21(19,20)14-6-4-5-12-11-17-10-7-13(12)14/h4-7,10-11,18H,3,8-9H2,1-2H3 |
| InChIKey | WZPDZORUUXRQLJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|