C9H17F3N2O2 — CID 106171924
2-hydroxy-3-(6,6,6-trifluorohexan-2-ylamino)propanamide (PubChem CID 106171924) has the molecular formula C9H17F3N2O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 2-hydroxy-3-(6,6,6-trifluorohexan-2-ylamino)propanamide.
| Compound Name | 2-hydroxy-3-(6,6,6-trifluorohexan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 106171924 |
| Molecular Formula | C9H17F3N2O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-hydroxy-3-(6,6,6-trifluorohexan-2-ylamino)propanamide |
| SMILES | CC(CCCC(F)(F)F)NCC(O)C(N)=O |
| InChI | InChI=1S/C9H17F3N2O2/c1-6(3-2-4-9(10,11)12)14-5-7(15)8(13)16/h6-7,14-15H,2-5H2,1H3,(H2,13,16) |
| InChIKey | NIHQKCHVGCLLHP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |