C17H17ClN2O — CID 106173624
1-chloro-N-[2-(cyclopenten-1-yl)ethyl]isoquinoline-3-carboxamide (PubChem CID 106173624) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is 1-chloro-N-[2-(cyclopenten-1-yl)ethyl]isoquinoline-3-carboxamide.
| Compound Name | 1-chloro-N-[2-(cyclopenten-1-yl)ethyl]isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 106173624 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1-chloro-N-[2-(cyclopenten-1-yl)ethyl]isoquinoline-3-carboxamide |
| SMILES | O=C(NCCC1=CCCC1)c1cc2ccccc2c(Cl)n1 |
| InChI | InChI=1S/C17H17ClN2O/c18-16-14-8-4-3-7-13(14)11-15(20-16)17(21)19-10-9-12-5-1-2-6-12/h3-5,7-8,11H,1-2,6,9-10H2,(H,19,21) |
| InChIKey | ZFGCPZRNLLYQHR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|