C9H16N2O2 — CID 106174834
3-(cyclohex-2-en-1-ylamino)-2-hydroxypropanamide (PubChem CID 106174834) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 3-(cyclohex-2-en-1-ylamino)-2-hydroxypropanamide.
| Compound Name | 3-(cyclohex-2-en-1-ylamino)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106174834 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 3-(cyclohex-2-en-1-ylamino)-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNC1C=CCCC1 |
| InChI | InChI=1S/C9H16N2O2/c10-9(13)8(12)6-11-7-4-2-1-3-5-7/h2,4,7-8,11-12H,1,3,5-6H2,(H2,10,13) |
| InChIKey | YTOSOSCUBGOLHE-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|