C17H31N3O2 — CID 162905308
(13S,17S)-17-[(1S)-1-hydroxypropyl]-1,6,10-triazabicyclo[11.4.0]heptadec-14-en-11-one (PubChem CID 162905308) has the molecular formula C17H31N3O2 and a molecular weight of 309.45 g/mol. Its IUPAC name is (13S,17S)-17-[(1S)-1-hydroxypropyl]-1,6,10-triazabicyclo[11.4.0]heptadec-14-en-11-one.
| Compound Name | (13S,17S)-17-[(1S)-1-hydroxypropyl]-1,6,10-triazabicyclo[11.4.0]heptadec-14-en-11-one |
|---|---|
| PubChem CID | 162905308 |
| Molecular Formula | C17H31N3O2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | (13S,17S)-17-[(1S)-1-hydroxypropyl]-1,6,10-triazabicyclo[11.4.0]heptadec-14-en-11-one |
| SMILES | CC[C@H](O)[C@@H]1CC=C[C@@H]2CC(=O)NCCCNCCCCN21 |
| InChI | InChI=1S/C17H31N3O2/c1-2-16(21)15-8-5-7-14-13-17(22)19-11-6-10-18-9-3-4-12-20(14)15/h5,7,14-16,18,21H,2-4,6,8-13H2,1H3,(H,19,22)/t14-,15+,16+/m1/s1 |
| InChIKey | VCOSELLDCZPJEJ-PMPSAXMXSA-N |
| XLogP | 1.04 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|