C17H30N2O — CID 106175418
4-amino-N-[2-(cyclopenten-1-yl)ethyl]-2,2,3-trimethylcyclohexane-1-carboxamide (PubChem CID 106175418) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is 4-amino-N-[2-(cyclopenten-1-yl)ethyl]-2,2,3-trimethylcyclohexane-1-carboxamide.
| Compound Name | 4-amino-N-[2-(cyclopenten-1-yl)ethyl]-2,2,3-trimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 106175418 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 4-amino-N-[2-(cyclopenten-1-yl)ethyl]-2,2,3-trimethylcyclohexane-1-carboxamide |
| SMILES | CC1C(N)CCC(C(=O)NCCC2=CCCC2)C1(C)C |
| InChI | InChI=1S/C17H30N2O/c1-12-15(18)9-8-14(17(12,2)3)16(20)19-11-10-13-6-4-5-7-13/h6,12,14-15H,4-5,7-11,18H2,1-3H3,(H,19,20) |
| InChIKey | UNDREAGGEOFZTC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|