C14H25F2NO3 — CID 106176951
2,2-difluoro-3-[[2-hydroxy-3-[(6-methylcyclohex-3-en-1-yl)methoxy]propyl]amino]propan-1-ol (PubChem CID 106176951) has the molecular formula C14H25F2NO3 and a molecular weight of 293.35 g/mol. Its IUPAC name is 2,2-difluoro-3-[[2-hydroxy-3-[(6-methylcyclohex-3-en-1-yl)methoxy]propyl]amino]propan-1-ol.
| Compound Name | 2,2-difluoro-3-[[2-hydroxy-3-[(6-methylcyclohex-3-en-1-yl)methoxy]propyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 106176951 |
| Molecular Formula | C14H25F2NO3 |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 2,2-difluoro-3-[[2-hydroxy-3-[(6-methylcyclohex-3-en-1-yl)methoxy]propyl]amino]propan-1-ol |
| SMILES | CC1CC=CCC1COCC(O)CNCC(F)(F)CO |
| InChI | InChI=1S/C14H25F2NO3/c1-11-4-2-3-5-12(11)7-20-8-13(19)6-17-9-14(15,16)10-18/h2-3,11-13,17-19H,4-10H2,1H3 |
| InChIKey | KJMVQPUMZLKVDI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|