C15H24F3NO2 — CID 106212592
1-[(6-methylcyclohex-3-en-1-yl)methoxy]-3-[[1-(trifluoromethyl)cyclopropyl]amino]propan-2-ol (PubChem CID 106212592) has the molecular formula C15H24F3NO2 and a molecular weight of 307.36 g/mol. Its IUPAC name is 1-[(6-methylcyclohex-3-en-1-yl)methoxy]-3-[[1-(trifluoromethyl)cyclopropyl]amino]propan-2-ol.
| Compound Name | 1-[(6-methylcyclohex-3-en-1-yl)methoxy]-3-[[1-(trifluoromethyl)cyclopropyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 106212592 |
| Molecular Formula | C15H24F3NO2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 1-[(6-methylcyclohex-3-en-1-yl)methoxy]-3-[[1-(trifluoromethyl)cyclopropyl]amino]propan-2-ol |
| SMILES | CC1CC=CCC1COCC(O)CNC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H24F3NO2/c1-11-4-2-3-5-12(11)9-21-10-13(20)8-19-14(6-7-14)15(16,17)18/h2-3,11-13,19-20H,4-10H2,1H3 |
| InChIKey | PJFWBTGBCTXGPX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|