C14H27NO2 — CID 3067065
1-(tert-butylamino)-3-(cyclohex-3-en-1-ylmethoxy)propan-2-ol (PubChem CID 3067065) has the molecular formula C14H27NO2 and a molecular weight of 241.38 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-(cyclohex-3-en-1-ylmethoxy)propan-2-ol.
| Compound Name | 1-(tert-butylamino)-3-(cyclohex-3-en-1-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 3067065 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 1-(tert-butylamino)-3-(cyclohex-3-en-1-ylmethoxy)propan-2-ol |
| SMILES | CC(C)(C)NCC(O)COCC1CC=CCC1 |
| InChI | InChI=1S/C14H27NO2/c1-14(2,3)15-9-13(16)11-17-10-12-7-5-4-6-8-12/h4-5,12-13,15-16H,6-11H2,1-3H3 |
| InChIKey | IKDRZBWDKODTED-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|