C14H24F3NO2S — CID 106429558
1-[(6-methylcyclohex-3-en-1-yl)methoxy]-3-[2-(trifluoromethylsulfanyl)ethylamino]propan-2-ol (PubChem CID 106429558) has the molecular formula C14H24F3NO2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-[(6-methylcyclohex-3-en-1-yl)methoxy]-3-[2-(trifluoromethylsulfanyl)ethylamino]propan-2-ol.
| Compound Name | 1-[(6-methylcyclohex-3-en-1-yl)methoxy]-3-[2-(trifluoromethylsulfanyl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 106429558 |
| Molecular Formula | C14H24F3NO2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-[(6-methylcyclohex-3-en-1-yl)methoxy]-3-[2-(trifluoromethylsulfanyl)ethylamino]propan-2-ol |
| SMILES | CC1CC=CCC1COCC(O)CNCCSC(F)(F)F |
| InChI | InChI=1S/C14H24F3NO2S/c1-11-4-2-3-5-12(11)9-20-10-13(19)8-18-6-7-21-14(15,16)17/h2-3,11-13,18-19H,4-10H2,1H3 |
| InChIKey | USYRYVHAUOIEHY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|