C15H26F3NO2 — CID 115518565
1-[(6-methylcyclohex-3-en-1-yl)methoxy]-3-(4,4,4-trifluorobutylamino)propan-2-ol (PubChem CID 115518565) has the molecular formula C15H26F3NO2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-[(6-methylcyclohex-3-en-1-yl)methoxy]-3-(4,4,4-trifluorobutylamino)propan-2-ol.
| Compound Name | 1-[(6-methylcyclohex-3-en-1-yl)methoxy]-3-(4,4,4-trifluorobutylamino)propan-2-ol |
|---|---|
| PubChem CID | 115518565 |
| Molecular Formula | C15H26F3NO2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 1-[(6-methylcyclohex-3-en-1-yl)methoxy]-3-(4,4,4-trifluorobutylamino)propan-2-ol |
| SMILES | CC1CC=CCC1COCC(O)CNCCCC(F)(F)F |
| InChI | InChI=1S/C15H26F3NO2/c1-12-5-2-3-6-13(12)10-21-11-14(20)9-19-8-4-7-15(16,17)18/h2-3,12-14,19-20H,4-11H2,1H3 |
| InChIKey | WFRHXRGSNFFESE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|