About 4-chloro-6-[(2,2-difluoro-3-hydroxypropyl)amino]-2-methylpyrimidine-5-carbaldehyde
4-chloro-6-[(2,2-difluoro-3-hydroxypropyl)amino]-2-methylpyrimidine-5-carbaldehyde (PubChem CID 106178799) has the molecular formula C9H10ClF2N3O2
and a molecular weight of 265.65 g/mol. Its IUPAC name is 4-chloro-6-[(2,2-difluoro-3-hydroxypropyl)amino]-2-methylpyrimidine-5-carbaldehyde.
Molecular Properties
| Compound Name | 4-chloro-6-[(2,2-difluoro-3-hydroxypropyl)amino]-2-methylpyrimidine-5-carbaldehyde |
| PubChem CID | 106178799 |
| Molecular Formula | C9H10ClF2N3O2 |
| Molecular Weight | 265.65 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 4-chloro-6-[(2,2-difluoro-3-hydroxypropyl)amino]-2-methylpyrimidine-5-carbaldehyde |
| SMILES | Cc1nc(Cl)c(C=O)c(NCC(F)(F)CO)n1 |
| InChI | InChI=1S/C9H10ClF2N3O2/c1-5-14-7(10)6(2-16)8(15-5)13-3-9(11,12)4-17/h2,17H,3-4H2,1H3,(H,13,14,15) |
| InChIKey | ZOKHTBMGVDRFDV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.65 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-6-[(2,2-difluoro-3-hydroxypropyl)amino]-2-methylpyrimidine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-[(2,2-difluoro-3-hydroxypropyl)amino]-2-methylpyrimidine-5-carbaldehyde?
The IUPAC name of 4-chloro-6-[(2,2-difluoro-3-hydroxypropyl)amino]-2-methylpyrimidine-5-carbaldehyde (CID 106178799) is 4-chloro-6-[(2,2-difluoro-3-hydroxypropyl)amino]-2-methylpyrimidine-5-carbaldehyde.
What is the SMILES notation for 4-chloro-6-[(2,2-difluoro-3-hydroxypropyl)amino]-2-methylpyrimidine-5-carbaldehyde?
The canonical SMILES for 4-chloro-6-[(2,2-difluoro-3-hydroxypropyl)amino]-2-methylpyrimidine-5-carbaldehyde is Cc1nc(Cl)c(C=O)c(NCC(F)(F)CO)n1.
What is the InChIKey of 4-chloro-6-[(2,2-difluoro-3-hydroxypropyl)amino]-2-methylpyrimidine-5-carbaldehyde?
The InChIKey is ZOKHTBMGVDRFDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClF2N3O2/c1-5-14-7(10)6(2-16)8(15-5)13-3-9(11,12)4-17/h2,17H,3-4H2,1H3,(H,13,14,15).
What are the key properties of 4-chloro-6-[(2,2-difluoro-3-hydroxypropyl)amino]-2-methylpyrimidine-5-carbaldehyde?
4-chloro-6-[(2,2-difluoro-3-hydroxypropyl)amino]-2-methylpyrimidine-5-carbaldehyde has a molecular weight of 265.65 g/mol, XLogP of 1.29, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-[(2,2-difluoro-3-hydroxypropyl)amino]-2-methylpyrimidine-5-carbaldehyde is sourced from PubChem (CID 106178799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).