C9H11ClN2O2 — CID 106181767
4-[(5-chlorofuran-2-yl)methylamino]pyrrolidin-2-one (PubChem CID 106181767) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is 4-[(5-chlorofuran-2-yl)methylamino]pyrrolidin-2-one.
| Compound Name | 4-[(5-chlorofuran-2-yl)methylamino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 106181767 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 4-[(5-chlorofuran-2-yl)methylamino]pyrrolidin-2-one |
| SMILES | O=C1CC(NCc2ccc(Cl)o2)CN1 |
| InChI | InChI=1S/C9H11ClN2O2/c10-8-2-1-7(14-8)5-11-6-3-9(13)12-4-6/h1-2,6,11H,3-5H2,(H,12,13) |
| InChIKey | CGKBYVJPXNPEMV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |