C9H16N2OS — CID 106182616
4-[(2-methylthiolan-3-yl)amino]pyrrolidin-2-one (PubChem CID 106182616) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is 4-[(2-methylthiolan-3-yl)amino]pyrrolidin-2-one.
| Compound Name | 4-[(2-methylthiolan-3-yl)amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 106182616 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 4-[(2-methylthiolan-3-yl)amino]pyrrolidin-2-one |
| SMILES | CC1SCCC1NC1CNC(=O)C1 |
| InChI | InChI=1S/C9H16N2OS/c1-6-8(2-3-13-6)11-7-4-9(12)10-5-7/h6-8,11H,2-5H2,1H3,(H,10,12) |
| InChIKey | SOPRMPLZJCQZCW-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |