C9H15NO — CID 45098359
(4aR,7S,7aR)-7-methyl-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-3-one (PubChem CID 45098359) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (4aR,7S,7aR)-7-methyl-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-3-one.
| Compound Name | (4aR,7S,7aR)-7-methyl-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-3-one |
|---|---|
| PubChem CID | 45098359 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (4aR,7S,7aR)-7-methyl-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-3-one |
| SMILES | C[C@H]1CC[C@@H]2CC(=O)NC[C@@H]21 |
| InChI | InChI=1S/C9H15NO/c1-6-2-3-7-4-9(11)10-5-8(6)7/h6-8H,2-5H2,1H3,(H,10,11)/t6-,7+,8+/m0/s1 |
| InChIKey | AESJVICLVCBBQV-XLPZGREQSA-N |
| XLogP | 1.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |