C8H15NO — CID 12689794
(4R,6R)-4,6-dimethylazepan-2-one (PubChem CID 12689794) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is (4R,6R)-4,6-dimethylazepan-2-one.
| Compound Name | (4R,6R)-4,6-dimethylazepan-2-one |
|---|---|
| PubChem CID | 12689794 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (4R,6R)-4,6-dimethylazepan-2-one |
| SMILES | C[C@H]1CNC(=O)C[C@H](C)C1 |
| InChI | InChI=1S/C8H15NO/c1-6-3-7(2)5-9-8(10)4-6/h6-7H,3-5H2,1-2H3,(H,9,10)/t6-,7-/m1/s1 |
| InChIKey | HWTDNNYOAGWISL-RNFRBKRXSA-N |
| XLogP | 1.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |