C13H23N3O3S — CID 106183615
4-amino-3-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-N-methylbenzenesulfonamide (PubChem CID 106183615) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is 4-amino-3-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-N-methylbenzenesulfonamide.
| Compound Name | 4-amino-3-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106183615 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4-amino-3-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N)c(NC(C)(C)C(C)(C)O)c1 |
| InChI | InChI=1S/C13H23N3O3S/c1-12(2,13(3,4)17)16-11-8-9(6-7-10(11)14)20(18,19)15-5/h6-8,15-17H,14H2,1-5H3 |
| InChIKey | DPHNHEWDAXOIGQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|