C11H17N3O2S — CID 82898673
4-amino-N-methyl-3-[(2-methylcyclopropyl)amino]benzenesulfonamide (PubChem CID 82898673) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 4-amino-N-methyl-3-[(2-methylcyclopropyl)amino]benzenesulfonamide.
| Compound Name | 4-amino-N-methyl-3-[(2-methylcyclopropyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 82898673 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-amino-N-methyl-3-[(2-methylcyclopropyl)amino]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N)c(NC2CC2C)c1 |
| InChI | InChI=1S/C11H17N3O2S/c1-7-5-10(7)14-11-6-8(3-4-9(11)12)17(15,16)13-2/h3-4,6-7,10,13-14H,5,12H2,1-2H3 |
| InChIKey | FWMSHKITALFRDL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|