C12H19N3O2S2 — CID 107294980
4-amino-N-methyl-3-(thiolan-3-ylmethylamino)benzenesulfonamide (PubChem CID 107294980) has the molecular formula C12H19N3O2S2 and a molecular weight of 301.44 g/mol. Its IUPAC name is 4-amino-N-methyl-3-(thiolan-3-ylmethylamino)benzenesulfonamide.
| Compound Name | 4-amino-N-methyl-3-(thiolan-3-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 107294980 |
| Molecular Formula | C12H19N3O2S2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 4-amino-N-methyl-3-(thiolan-3-ylmethylamino)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N)c(NCC2CCSC2)c1 |
| InChI | InChI=1S/C12H19N3O2S2/c1-14-19(16,17)10-2-3-11(13)12(6-10)15-7-9-4-5-18-8-9/h2-3,6,9,14-15H,4-5,7-8,13H2,1H3 |
| InChIKey | QXPIHYGFMLYWRA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|