C12H19N3O4S — CID 82898527
4-amino-3-(1,4-dioxan-2-ylmethylamino)-N-methylbenzenesulfonamide (PubChem CID 82898527) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is 4-amino-3-(1,4-dioxan-2-ylmethylamino)-N-methylbenzenesulfonamide.
| Compound Name | 4-amino-3-(1,4-dioxan-2-ylmethylamino)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 82898527 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 4-amino-3-(1,4-dioxan-2-ylmethylamino)-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N)c(NCC2COCCO2)c1 |
| InChI | InChI=1S/C12H19N3O4S/c1-14-20(16,17)10-2-3-11(13)12(6-10)15-7-9-8-18-4-5-19-9/h2-3,6,9,14-15H,4-5,7-8,13H2,1H3 |
| InChIKey | XEVJQXASYBIPRN-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|