C18H37NO4Si — CID 10618479
(2S,3S)-3-methyl-2-[[5-[(2-methylpropan-2-yl)oxy]-5-oxopentyl]-trimethylsilylamino]pentanoic acid (PubChem CID 10618479) has the molecular formula C18H37NO4Si and a molecular weight of 359.58 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[[5-[(2-methylpropan-2-yl)oxy]-5-oxopentyl]-trimethylsilylamino]pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-[[5-[(2-methylpropan-2-yl)oxy]-5-oxopentyl]-trimethylsilylamino]pentanoic acid |
|---|---|
| PubChem CID | 10618479 |
| Molecular Formula | C18H37NO4Si |
| Molecular Weight | 359.58 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (2S,3S)-3-methyl-2-[[5-[(2-methylpropan-2-yl)oxy]-5-oxopentyl]-trimethylsilylamino]pentanoic acid |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)N(CCCCC(=O)OC(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H37NO4Si/c1-9-14(2)16(17(21)22)19(24(6,7)8)13-11-10-12-15(20)23-18(3,4)5/h14,16H,9-13H2,1-8H3,(H,21,22)/t14-,16-/m0/s1 |
| InChIKey | YSBIVGAIJODSON-HOCLYGCPSA-N |
| XLogP | 4.13 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|